- Isodeoxyelephantopin
-
- $228.00 / 1mg
-
2026-04-21
- CAS:38927-54-7
- Min. Order:
- Purity: 99.88%
- Supply Ability: 10g
- Isodeoxyelephantopin
-
- $2.00 / 1KG
-
2019-12-24
- CAS:38927-54-7
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 100kg
|
| | Isodeoxyelephantopin Basic information |
| Product Name: | Isodeoxyelephantopin | | Synonyms: | Isodeoxyelephantopin;sodeoxyelephantopin;2-Propenoic acid, 2-methyl-, (3aR,4S,9S,11E,12aR)-2,3,3a,4,5,9,10,12a-octahydro-11-methyl-3-methylene-2,7-dioxo-7H-9,6-methenofuro[2,3-f]oxacycloundecin-4-yl ester;inhibit,Reactive Oxygen Species,Inhibitor,Isodeoxyelephantopin,NF-κB,Nuclear factor-κB,Nuclear factor-kappaB,Autophagy;Isodeoxyelephantopin, 10 mM in DMSO | | CAS: | 38927-54-7 | | MF: | C19H20O6 | | MW: | 344.36 | | EINECS: | | | Product Categories: | | | Mol File: | 38927-54-7.mol |  |
| | Isodeoxyelephantopin Chemical Properties |
| Boiling point | 584.3±50.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO | | form | Solid | | color | White to off-white | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C19H20O6/c1-9(2)17(20)24-15-8-12-7-13(23-19(12)22)5-10(3)6-14-16(15)11(4)18(21)25-14/h6-7,13-16H,1,4-5,8H2,2-3H3/b10-6+/t13,14-,15+,16-/m1/s1 | | InChIKey | JMUOPRSXUVOHFE-FZAAMHSTSA-N | | SMILES | CC(=C)C(=O)O[C@H]1CC2=CC(C\C(C)=C\[C@H]3OC(=O)C(=C)[C@@H]13)OC2=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Isodeoxyelephantopin Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Elephantopus scaber. | | Uses | Isodeoxyelephantopin is a sesquiterpene lactone from Elephantopus mollis and displays anti-inflammatory activity. |
| | Isodeoxyelephantopin Preparation Products And Raw materials |
|