- Barlerin
-
- $34.00
-
2026-04-20
- CAS:57420-46-9
- Purity: 99.83%
- Supply Ability: 10g
|
| | 8-O-Acetylshanzhiside methyl ester Basic information |
| Product Name: | 8-O-Acetylshanzhiside methyl ester | | Synonyms: | (1S)-1α-(β-D-Glucopyranosyloxy)-5α-hydroxy-7α-acetoxy-7-methyl-1,4aα,5,6,7,7aα-hexahydrocyclopenta[c]pyran-4-carboxylic acid methyl ester;1α-(β-D-Glucopyranosyloxy)-7α-acetoxy-5α-hydroxy-7-methyl-1,4aα,5,6,7,7aα-hexahydrocyclopenta[c]pyran-4-carboxylic acid methyl ester;7α-Acetoxy-1α-(β-D-glucopyranosyloxy)-1,4aα,5,6,7,7aα-hexahydro-5α-hydroxy-7-methylcyclopenta[c]pyran-4-carboxylic acid methyl ester;O-Acetyl Shanzhiside Methyl Ester, 8-;8-Acetylshanzhiside Methyl ester;UMbroside;8-O-Acetyl shanzhiside methyl ester, 98%, from Lamiophlomis rotata (Benth. ex Hook.f.) Kud;8-O-Acetyl shanzhiside methyl ester, >98% | | CAS: | 57420-46-9 | | MF: | C19H28O12 | | MW: | 448.42 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 57420-46-9.mol |  |
| | 8-O-Acetylshanzhiside methyl ester Chemical Properties |
| Boiling point | 634.2±55.0 °C(Predicted) | | density | 1.52 | | storage temp. | -20°C | | solubility | Soluble in methan | | form | powder | | pka | 12.80±0.70(Predicted) | | color | White | | Major Application | food and beverages | | InChIKey | ARFRZOLTIRQFCI-NGQYDJQZSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)O[C@@H]2OC=C([C@@H]3[C@H]2[C@](C[C@H]3O)(OC(=O)C)C)C(=O)OC |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29389090 | | Storage Class | 11 - Combustible Solids |
| | 8-O-Acetylshanzhiside methyl ester Usage And Synthesis |
| Chemical Properties | Off-white crystalline powder, easily soluble in methanol and ethanol, derived from unique flavor. | | Uses | 8-O-acetyl shanzhiside methyl ester can be used for content determination, identification and pharmacological experiments, etc. It can activate congestion, relieve pain and stop bleeding. | | in vitro | Treatment of SH-SY5Y cells with 8-O-Acetyl shanzhiside methyl ester blocks TNF-α-induced nuclear transcription factor κB (NF-κB) activation and decreases high-mobility group box-1 ( HMGB-1) expression . Treatment of H9c2 cells with it 9 μM blocks TNF-α-induced NF-κB phosphorylation by blocking High-mobility group box1 (HMGB1) expression. | | in vivo | 8-O-Acetyl shanzhiside methyl ester significantly promotes angiogenesis in the ischaemic brain and improves functional outcome after stroke. It also significantly increases vascularization compared with vehicle treatment. 8-O-Acetyl shanzhiside methyl ester significantly shortens capillary blood clotting time and reduces blood loss volume, but does not influence mice activated partial thromboplastin time , prothrombin time or thrombin time. |
| | 8-O-Acetylshanzhiside methyl ester Preparation Products And Raw materials |
|