- Fmoc-D-Aph(Cbm)-OH
-
- $150.00
-
2023-06-26
- CAS:324017-22-3
- Min. Order: 10g
- Purity: more than 99.6%
- Supply Ability: 500kg/month
|
| | 4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine Basic information |
| Product Name: | 4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine | | Synonyms: | 4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine;(9H-Fluoren-9-yl)MethOxy]Carbonyl D-Aph(Cbm)-OH;Fmoc-D-4-Aph(cbm);(2R)-3-[4-(carbamoylamino)phenyl]-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid;D-Phenylalanine, 4-[(aminocarbonyl)amino]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-;4-[(Aminocarbonyl)amino]-N-Fmoc-D-phenylalanine;Fmoc-D-Aph(Cbm);Fmoc-D-Phe(4-[(NH2CO)NH2])-OH | | CAS: | 324017-22-3 | | MF: | C25H23N3O5 | | MW: | 445.47 | | EINECS: | | | Product Categories: | | | Mol File: | 324017-22-3.mol | ![4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine Structure](CAS/20150408/GIF/324017-22-3.gif) |
| | 4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine Chemical Properties |
| Melting point | 163℃ (decomposition) | | Boiling point | 699.1±55.0 °C(Predicted) | | density | 1.376±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | pka | 3.82±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | HFPDOFBZCSQAEJ-JOCHJYFZSA-N | | SMILES | C(O)(=O)[C@@H](CC1=CC=C(NC(N)=O)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | 4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine Usage And Synthesis |
| Uses | Fmoc-D-4-Aph(cBm)-OH is an amino acid derivative with an Fmoc protecting group, which can be used to synthesize biologically active peptide mimetics, such as Ac-D2Nal-D4Cpa-D3Pal-Ser-4Aph/4Amf(P)-D4Aph/D4Amf(Q)-Leu-ILys-Pro-DAla-NH2 with gonadotropin-releasing hormone (GnRH) antagonist activity[1]. | | References | [1] Guangcheng Jiang, et al. "GnRH antagonists: a new generation of long acting analogues incorporating p-ureido-phenylalanines at positions 5 and 6." Journal of medicinal chemistry 44.3 (2001): 453-467. DOI:10.1021/jm0003900 |
| | 4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine Preparation Products And Raw materials |
|