| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Pomalidomide-PEG1-azide manufacturers
|
| | Pomalidomide-PEG1-azide Basic information |
| Product Name: | Pomalidomide-PEG1-azide | | Synonyms: | Pomalidomide-PEG1-azide;Pomalidomide-NH-CO-PEG1-N3;2-(2-Azidoethoxy)-N-[2-(2,6-dioxo-3-piperidyl)-1,3-dioxoisoindolin-4-yl]acetamide;N3-PEG1-CH2CO-Poma;Acetamide, 2-(2-azidoethoxy)-N-[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]-;2-(2-Azidoethoxy)-N-(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)acetamide?, Pomalidomide-PEG1-azide;Pomalidomide-PEG1-azide/Acetamide,2-(2-azidoethoxy)-N-[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]-;2-(2-Azidoethoxy)-N-[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]acetamide | | CAS: | 2133360-04-8 | | MF: | C17H16N6O6 | | MW: | 400.35 | | EINECS: | | | Product Categories: | peg | | Mol File: | 2133360-04-8.mol |  |
| | Pomalidomide-PEG1-azide Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO : 62.5 mg/mL (156.11 mM; ultrasonic and warming and heat to 60°C) | | form | Solid | | color | Light yellow to yellow | | InChIKey | SKTGGMFEGRISBY-UHFFFAOYSA-N | | SMILES | O=C(C(CC1)N(C2=O)C(C3=C2C=CC=C3NC(COCCN=[N+]=[N-])=O)=O)NC1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Pomalidomide-PEG1-azide Usage And Synthesis |
| Uses | Protein degrader builiding block Pomalidomide-PEG1-azide enables the synthesis of molecules for targeted protein degradation and PROTAC (proteolysis-targeting chimeras) technology. This conjugate contains Cereblon (CRBN)-recruiting ligand and a PEGylated crosslinker with pendant azide for click chemistry with a target ligand. Because even slight alterations in ligands and crosslinkers can affect ternary complex formation between the target, E3 ligase, and PROTAC, many analogs are prepared to screen for optimal target degradation When used with other protein degrader building blocks with a pendant azide group, parallel synthesis can be used to more quickly generate PROTAC libraries that feature variation in crosslinker length, composition, and E3 ligase ligand. | | reaction suitability | reaction type: click chemistry reagent type: ligand-linker conjugate |
| | Pomalidomide-PEG1-azide Preparation Products And Raw materials |
|