| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | S(+)-1-phenyl-2-propanol Basic information |
| | S(+)-1-phenyl-2-propanol Chemical Properties |
| Boiling point | 95-97 °C11 mm Hg(lit.) | | density | 0.993 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.521 | | Fp | 85 °C | | storage temp. | Sealed in dry,Room Temperature | | pka | 15.24±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Optical Rotation | [α]20/D +41±1°, c = 5.3% in benzene | | BRN | 2553541 | | InChI | InChI=1/C9H12O/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3/t8-/s3 | | InChIKey | WYTRYIUQUDTGSX-SBYBRXNCNA-N | | SMILES | C1(C[C@@H](O)C)=CC=CC=C1 |&1:2,r| | | CAS DataBase Reference | 1517-68-6 |
| Safety Statements | 23-24/25 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 2905120090 |
| | S(+)-1-phenyl-2-propanol Usage And Synthesis |
| | S(+)-1-phenyl-2-propanol Preparation Products And Raw materials |
|