| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Hexafluoroglutaric anhydride Basic information |
| Product Name: | Hexafluoroglutaric anhydride | | Synonyms: | PERFLUOROGLUTARIC ANHYDRIDE;3,3,4,4,5,5-HEXAFLUORODIHYDRO-2H-PYRAN-2,6(3H)-DIONE;2,2,3,3,4,4-HEXAFLUOROPENTANEDIOIC ANHYDRIDE;2,2,3,3,4,4-HEXAFLUOROGLUTARIC ANHYDRIDE;Hexafluoroglutaricanhydride,min.97%;Hexafluoroglutaric anhydride 98%;Hexafluoroglutaricanhydride98%;Hexafluoroglutaric anhydride, min. 97% | | CAS: | 376-68-1 | | MF: | C5F6O3 | | MW: | 222.04 | | EINECS: | 206-811-8 | | Product Categories: | Anhydride Monomers;Monomers;Polymer Science | | Mol File: | 376-68-1.mol |  |
| | Hexafluoroglutaric anhydride Chemical Properties |
| Boiling point | 72 °C (lit.) | | density | 1.654 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.324(lit.) | | Fp | None | | form | clear liquid | | Specific Gravity | 1.654 | | color | Colorless to Almost colorless | | Sensitive | Moisture Sensitive | | BRN | 210699 | | InChI | InChI=1S/C5F6O3/c6-3(7)1(12)14-2(13)4(8,9)5(3,10)11 | | InChIKey | IHYAGCYJVNHXCT-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)C(F)(F)C(F)(F)C1(F)F | | CAS DataBase Reference | 376-68-1(CAS DataBase Reference) | | EPA Substance Registry System | Perfluoroglutaric anhydride (376-68-1) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 3265 | | WGK Germany | 3 | | RTECS | TM0860000 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29171900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B
STOT SE 3 |
| | Hexafluoroglutaric anhydride Usage And Synthesis |
| Chemical Properties | Clear colorless to pale yellow liquid |
| | Hexafluoroglutaric anhydride Preparation Products And Raw materials |
|