| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2,4,6-Trimethoxybenzylamine hydrochloride manufacturers
|
| | 2,4,6-Trimethoxybenzylamine hydrochloride Basic information |
| Product Name: | 2,4,6-Trimethoxybenzylamine hydrochloride | | Synonyms: | TIMTEC-BB SBB003257;2,4,6-TRIMETHOXYBENZYLAMINE HYDROCHLORIDE;(2,4,6-triMethoxyphenyl)MethanaMine hydrochloride;2,4,6-TRIMETHOXYBENZYLAMINE HYDROCHLORIDE,98%;2,4,6-TrimethoxybenzylamineHCl;2,4,6-Trimethoxybenz;BenzeneMethanaMine, 2,4,6-triMethoxy-, hydrochloride (1:1);2,4,6-Trimethoxybenzylamine hydrochloride 98% | | CAS: | 146548-59-6 | | MF: | C10H16ClNO3 | | MW: | 233.69 | | EINECS: | 213-630-8 | | Product Categories: | Amine Salts;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 146548-59-6.mol |  |
| | 2,4,6-Trimethoxybenzylamine hydrochloride Chemical Properties |
| Melting point | 204-207 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | White to off-white | | InChI | 1S/C10H15NO3.ClH/c1-12-7-4-9(13-2)8(6-11)10(5-7)14-3;/h4-5H,6,11H2,1-3H3;1H | | InChIKey | BLFRMOOGAICNSZ-UHFFFAOYSA-N | | SMILES | Cl.COc1cc(OC)c(CN)c(OC)c1 | | CAS DataBase Reference | 146548-59-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,4,6-Trimethoxybenzylamine hydrochloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 2,4,6-Trimethoxybenzylamine hydrochloride was used in synthesis of 3-(aminomethyl)isoquinoline. |
| | 2,4,6-Trimethoxybenzylamine hydrochloride Preparation Products And Raw materials |
|