| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- BOC-ILE-OSU
-
- $1.00
-
2024-07-20
- CAS:3392-08-3
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | Boc-Ile-OSu Basic information |
| Product Name: | Boc-Ile-OSu | | Synonyms: | BOC-ISOLEUCINE-OSU;(2S)-2,5-Dioxopyrrolidin-1-yl2-((tert-butoxycarbonyl)amino)-3-methylpentanoate;2,5-dioxopyrrolidin-1-yl (2S,3S)-2-{[(tert-butoxy)carbonyl]amino}-3-methylpentanoate;BOC-L-ISOLEUCINE HYDROXYSUCCINIMIDE ESTER;BOC-L-ISOLEUCINE N-HYDROXYSUCCINIMIDE ESTER;BOC-L-ISOLEUCINE-OSU;N-ALPHA-T-BOC-L-ISOLEUCINE N-HYDROXYSUCCINIMIDE ESTER;Boc-L-Ile-OSu | | CAS: | 3392-08-3 | | MF: | C15H24N2O6 | | MW: | 328.36 | | EINECS: | 222-231-8 | | Product Categories: | AMINOACIDS DERIVATIVES;Amino Acid Derivatives;Boc-Amino Acids and Derivative | | Mol File: | 3392-08-3.mol |  |
| | Boc-Ile-OSu Chemical Properties |
| Melting point | 103-108 °C | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | pka | 10.81±0.46(Predicted) | | color | White | | InChI | InChI=1S/C15H24N2O6/c1-6-9(2)12(16-14(21)22-15(3,4)5)13(20)23-17-10(18)7-8-11(17)19/h9,12H,6-8H2,1-5H3,(H,16,21)/t9-,12-/m0/s1 | | InChIKey | FATJLEZSGFVHQA-CABZTGNLSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)[C@H]([C@@H](C)CC)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 3392-08-3(CAS DataBase Reference) |
| | Boc-Ile-OSu Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Boc-Ile-OSu is used in preparation of Dipeptide Piperidine derivatives for treating or preventing a disease associated with arginase activity. |
| | Boc-Ile-OSu Preparation Products And Raw materials |
|