(S)-(+)-1-Indanol manufacturers
- (S)-(+)-1-Indanol
-
- $6.68 / 1KG
-
2020-01-09
- CAS: 25501-32-0
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | (S)-(+)-1-Indanol Basic information |
| Product Name: | (S)-(+)-1-Indanol | | Synonyms: | (S)-(+)-1-HYDROXYINDAN;(S)-(+)-1-INDANOL;(1S)-2,3-Dihydro-1H-indene-1β-ol;(1S)-Indan-1β-ol;(3S)-Indan-3-ol;(S)-2,3-Dihydro-1H-indene-1β-ol;[1S,(+)]-1-Indanol;(S)-(+)-1-Indanol | | CAS: | 25501-32-0 | | MF: | C9H10O | | MW: | 134.18 | | EINECS: | | | Product Categories: | Chiral | | Mol File: | 25501-32-0.mol |  |
| | (S)-(+)-1-Indanol Chemical Properties |
| Melting point | 69-73 °C (lit.) | | alpha | 30 º (c=2 in chloroform) | | Boiling point | 210 °C(Press: 5 Torr) | | density | 1.161±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 14.23±0.20(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +30°, c = 2 in chloroform | | BRN | 2206709 | | InChI | InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2/t9-/m0/s1 | | InChIKey | YIAPLDFPUUJILH-VIFPVBQESA-N | | SMILES | [C@@H]1(O)C2=C(C=CC=C2)CC1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2906290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (S)-(+)-1-Indanol Usage And Synthesis |
| Uses | (S)?-?(+)?-?1-?Indanol is a building block used in pharmaceutical synthesis such as orally bioavailable GPR40 agonists such as DS-1558 used to stimulate insulin secretion. | | Definition | ChEBI: (S)-(+)-1-indanol is an indan-1-ol in which the carbon bearing the hydroxy group has S configuration. |
| | (S)-(+)-1-Indanol Preparation Products And Raw materials |
|