|
|
| | 4-Ethoxy-2,3-difluorophenol Basic information |
| Product Name: | 4-Ethoxy-2,3-difluorophenol | | Synonyms: | 4-Ethoxy-2,3-difluorophenol;4-Ethoxy-2,3-difluorophenol, J;4-Ethoxy-2,3-difluorophenol, JRD, 97%;4-Ethoxy-2,3-difluorophenol 2,3-Difluoro-4-ethoxyphenol;2,3-Difluoro-4-ethyoxyphenol;Phenol, 4-ethoxy-2,3-difluoro-;4-Ethoxy-2,3-difluorophenol,97%;1-HYDROXY-4-ETHOXY-2,3-DIFLUOROBENZENE ISO 9001：2015 REACH | | CAS: | 126163-56-2 | | MF: | C8H8F2O2 | | MW: | 174.14 | | EINECS: | | | Product Categories: | | | Mol File: | 126163-56-2.mol |  |
| | 4-Ethoxy-2,3-difluorophenol Chemical Properties |
| Melting point | 73℃ | | Boiling point | 235℃ | | density | 1.273 | | Fp | 116℃ | | storage temp. | Inert atmosphere,Room Temperature | | pka | 8.26±0.23(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H8F2O2/c1-2-12-6-4-3-5(11)7(9)8(6)10/h3-4,11H,2H2,1H3 | | InChIKey | PKIYFPSPIFCDDB-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(OCC)C(F)=C1F |
| | 4-Ethoxy-2,3-difluorophenol Usage And Synthesis |
| Chemical Properties | white solid | | Synthesis | In a 1 L four-reaction vessel, 326.7 g of tetrahydrofuran and 132.9 g of glacial acetic acid were added, stirred for 30 min,Adding 110.0g 2.3-difluoro-4-ethoxybenzeneboronic acid crude, stirring for half an hour, the control temperature between 15 ~ 25 ° C,Dropping 111. 1 g of hydrogen peroxide, stirring was added dropwise insulation lh, sample testing, raw material residue 0.15%To the vessel was added water 200.0g and 15. lg sodium sulfite treatment, stratification, the upper organic phase rejection rate was 2.3-difluoro-4-ethoxy phenol crude 85.0g, distilled product 64.8g, GC purity: 99 96 %, Two-step yield 69 8% |
| | 4-Ethoxy-2,3-difluorophenol Preparation Products And Raw materials |
|