|
|
| | 4-METHOXY-3-BUTEN-2-ONE Basic information |
| Product Name: | 4-METHOXY-3-BUTEN-2-ONE | | Synonyms: | 4-METHOXY-3-BUTEN-2-ONE;TRANS-1-METHOXY-1-BUTEN-3-ONE;TRANS-4-METHOXY-3-BUTEN-2-ONE;4-Methoxy-3-buten-2-one, tech., 90%;4-Methoxy-3-buten-2-one, 90%,tech;1-Methoxy-1-buten-3-one;2-Methoxyvinyl methyl ketone;4-Methoxy-3-buten-2-one ,95% | | CAS: | 4652-27-1 | | MF: | C5H8O2 | | MW: | 100.12 | | EINECS: | 225-087-4 | | Product Categories: | | | Mol File: | 4652-27-1.mol |  |
| | 4-METHOXY-3-BUTEN-2-ONE Chemical Properties |
| Boiling point | 200 °C(lit.) | | density | 0.982 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.468(lit.) | | Fp | 146 °F | | storage temp. | Sealed in dry,2-8°C | | solubility | Miscible with tetrahydrofuran, ether, acetonitrile and benzene. | | form | Liquid | | color | Clear yellow | | BRN | 1741053 | | InChI | InChI=1S/C5H8O2/c1-5(6)3-4-7-2/h3-4H,1-2H3 | | InChIKey | VLLHEPHWWIDUSS-UHFFFAOYSA-N | | SMILES | CC(=O)C=COC |
| | 4-METHOXY-3-BUTEN-2-ONE Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | 4-Methoxy-3-buten-2-one is an important precursor for the synthesis of 1-methoxy-3-trimethylsilyloxy-1,3-butadiene and the Danishefsky diene and its equivalent. It is widely used as a reactant in the synthesis of hydroisoquinoline derivatives. It is employed as an intermediate for the synthesis of manzamine. | | Toxics Screening Level | Due to a lack of available toxicity information the ITSL is being set at the default value of 0.1 μg/m3 with annual averaging, based on R232(1)(i). |
| | 4-METHOXY-3-BUTEN-2-ONE Preparation Products And Raw materials |
|