| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2'-Hydroxy-4,4',6'-trimethoxychalcone manufacturers
|
| | 2'-Hydroxy-4,4',6'-trimethoxychalcone Basic information |
| Product Name: | 2'-Hydroxy-4,4',6'-trimethoxychalcone | | Synonyms: | 1-(2-Hydroxy-4,6-diMethoxyphenyl)-3-(4-Methoxyphenyl)prop-2-en-1-one;FLAVOKAWIN A;(E)-1-(2-HYDROXY-4,6-DIMETHOXYPHENYL)-3-(4-METHOXYPHENYL)PROP-2-EN-1-ONE;1-(2-HYDROXY-4,6-DIMETHOXYPHENYL)-3-(4-METHOXYPHENYL)-2-PROPEN-1-ONE;2'-Hydroxy-4,4',6'-trimethoxy;4-Methoxybenzylidene(4,6-dimethoxy-2-hydroxyacetophenone);(2E)-1-(2,4-Dimethoxy-6-hydroxyphenyl)-3-(4-methoxyphenyl)-2-propene-1-one;(E)-1-(2,4-Dimethoxy-6-hydroxyphenyl)-3-(4-methoxyphenyl)-2-propene-1-one | | CAS: | 3420-72-2 | | MF: | C18H18O5 | | MW: | 314.33 | | EINECS: | | | Product Categories: | Chalcones;Plant Oils, Toxins, Phenolic Acids & Derivatives;Chemical Synthesis;Organic Building Blocks;C15 to C38;Carbonyl Compounds;Ketones;Building Blocks;C15 to C38;Carbonyl Compounds | | Mol File: | 3420-72-2.mol |  |
| | 2'-Hydroxy-4,4',6'-trimethoxychalcone Chemical Properties |
| Melting point | 112-116 °C(lit.) | | Boiling point | 529.9±50.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.78±0.40(Predicted) | | color | Pale Yellow to Light Yellow | | InChI | 1S/C18H18O5/c1-21-13-7-4-12(5-8-13)6-9-15(19)18-16(20)10-14(22-2)11-17(18)23-3/h4-11,20H,1-3H3/b9-6+ | | InChIKey | CGIBCVBDFUTMPT-RMKNXTFCSA-N | | SMILES | COc1ccc(\C=C\C(=O)c2c(O)cc(OC)cc2OC)cc1 | | CAS DataBase Reference | 3420-72-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2914.50.3000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2'-Hydroxy-4,4',6'-trimethoxychalcone Usage And Synthesis |
| Chemical Properties | Pale yellow powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the rhizome of Piper methysticum Forst. | | Uses | 2′-Hydroxy-4,4′,6′-trimethoxychalcone may be used to synthesize 2′,2”′-dihydroxy-4,4′,4′′,4”′,6′,6′′′-hexamethoxy[5′,5′′′]bichalcone and 3′-bromo-4,4′,6′-trimethoxy-2′-hydroxychalcone. | | Definition | ChEBI: Flavokawain A is a member of chalcones. |
| | 2'-Hydroxy-4,4',6'-trimethoxychalcone Preparation Products And Raw materials |
|