|
|
| | Ethyl tetrazole-5-carboxylate Basic information |
| Product Name: | Ethyl tetrazole-5-carboxylate | | Synonyms: | ETHYL TETRAZOLE-5-CARBOXYLATE;ETHYL 1H-TETRAZOLE-5-CARBOXYLATE;1H-TETRAZOL-5-ETHYL FORMATE;5-ETHOXYCARBONYL-1H-TETRAZOLE;5-TETRAZOLECARBOXYLIC ACID ETHYL ESTER;1H-Tetrazolyl-5-Carboxylicacidethylester;T5CE;1H-TETRAZOLYL-5-CARBOXYLIC ACID ETHYL ESTER OR (5-ETHOXYCARBONYL-1H-TETRAZOLE) | | CAS: | 55408-10-1 | | MF: | C4H6N4O2 | | MW: | 142.12 | | EINECS: | 816-590-5 | | Product Categories: | (intermediate of pranlukast);bc0001 | | Mol File: | 55408-10-1.mol |  |
| | Ethyl tetrazole-5-carboxylate Chemical Properties |
| Melting point | 88-93°C | | Boiling point | 285.8±23.0 °C(Predicted) | | density | 1.395±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly) | | form | Solid | | pka | 2.83±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C4H6N4O2/c1-2-10-4(9)3-5-7-8-6-3/h2H2,1H3,(H,5,6,7,8) | | InChIKey | JBEHAOGLPHSQSL-UHFFFAOYSA-N | | SMILES | N1=C(C(OCC)=O)N=NN1 | | CAS DataBase Reference | 55408-10-1(CAS DataBase Reference) |
| | Ethyl tetrazole-5-carboxylate Usage And Synthesis |
| Uses | Ethyl tetrazole-5-carboxylate is a reagent used in the preparation if pyrazole acids which has niacin receptor agonistic activity and is usefull for the treatment of dyslipidemia. |
| | Ethyl tetrazole-5-carboxylate Preparation Products And Raw materials |
|