|
|
| | 4-Methoxytetrafluorobenzyl bromide Basic information |
| Product Name: | 4-Methoxytetrafluorobenzyl bromide | | Synonyms: | 2,3,5,6-TETRAFLUORO-4-METHOXYBENZYL BROMIDE;4-Methoxytetrafluorobenzylbromide85%;2,3,5,6-TETRAFLUORO-4-METHOXYBENZYL BROMIDE 97%;4-Methoxy-2,3,5,6-tetrafluorobenzyl bromide 97%;4-(Bromomethyl)-2,3,5,6-tetrafluoroanisole;4-Methoxy-2,3,5,6-tetrafluorobenzylbromide97%;4-Methoxy-2,3,5,6-tetrafluorobenzyl bromide;1-[bromo(difluoro)methyl]-2,3-difluoro-4-methoxybenzene | | CAS: | 4910-40-1 | | MF: | C8H5BrF4O | | MW: | 273.02 | | EINECS: | | | Product Categories: | | | Mol File: | 4910-40-1.mol |  |
| | 4-Methoxytetrafluorobenzyl bromide Chemical Properties |
| Boiling point | 100 °C | | density | 1.708±0.06 g/cm3(Predicted) | | form | liquid | | color | Clear, light yellow | | Sensitive | Lachrymatory | | InChI | InChI=1S/C8H5BrF4O/c1-14-8-6(12)4(10)3(2-9)5(11)7(8)13/h2H2,1H3 | | InChIKey | SNPXIYPEWUELMV-UHFFFAOYSA-N | | SMILES | C1(CBr)=C(F)C(F)=C(OC)C(F)=C1F | | CAS DataBase Reference | 4910-40-1(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 1760 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | LACHRYMATOR, CORROSIVE | | HS Code | 2909309090 |
| | 4-Methoxytetrafluorobenzyl bromide Usage And Synthesis |
| | 4-Methoxytetrafluorobenzyl bromide Preparation Products And Raw materials |
|