| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-BROMO-3-FLUOROBENZOTRIFLUORIDE Basic information |
| Product Name: | 2-BROMO-3-FLUOROBENZOTRIFLUORIDE | | Synonyms: | 2-Bromo-1-fluoro-3-(trifluoromethyl)benzene;1-BROMO-2-FLUORO-6-(TRIFLUOROMETHYL)BENZENE;2-BROMO-3-FLUOROBENZOTRIFLUORIDE;2-FLUORO-6-(TRIFLUOROMETHYL)BROMOBENZENE;2-Bromo-1-fluoro-3-(trifluoromethyl)benzene~2-Fluoro-6-(trifluoromethyl)bromobenzene;2-Bromo-3-fluorobenzotrifluoride, 97+%;2-Bromo-3-fluorobenzotrifluoride 98%;2-Bromo-3-fluorobenzotrifluoride98% | | CAS: | 104540-42-3 | | MF: | C7H3BrF4 | | MW: | 243 | | EINECS: | | | Product Categories: | Aryl;C7;Halogenated Hydrocarbons | | Mol File: | 104540-42-3.mol |  |
| | 2-BROMO-3-FLUOROBENZOTRIFLUORIDE Chemical Properties |
| Melting point | 167-168° | | Boiling point | 167-168 °C (lit.) | | density | 1.741 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.47(lit.) | | Fp | 190 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C7H3BrF4/c8-6-4(7(10,11)12)2-1-3-5(6)9/h1-3H | | InChIKey | UERAGXKMOXUWPC-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(C(F)(F)F)=C1Br | | CAS DataBase Reference | 104540-42-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36/37/39-36 | | RIDADR | UN 1993 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids |
| | 2-BROMO-3-FLUOROBENZOTRIFLUORIDE Usage And Synthesis |
| | 2-BROMO-3-FLUOROBENZOTRIFLUORIDE Preparation Products And Raw materials |
|