|
|
| | 4-Bromo-2-thiophenecarboxylic acid Basic information |
| | 4-Bromo-2-thiophenecarboxylic acid Chemical Properties |
| Melting point | 121 °C | | Boiling point | 323.7±27.0 °C(Predicted) | | density | 1.923±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 3.50±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | λmax | 245nm(EtOH)(lit.) | | InChI | InChI=1S/C5H3BrO2S/c6-3-1-4(5(7)8)9-2-3/h1-2H,(H,7,8) | | InChIKey | HJZFPRVFLBBAMU-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)SC=C(Br)C=1 | | CAS DataBase Reference | 16694-18-1(CAS DataBase Reference) |
| | 4-Bromo-2-thiophenecarboxylic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 4-Bromo-2-thiophenecarboxylic Acid, can be used as an intermediate for the synthesis of N-(4-Bromo-2-thienyl)-carbamic Acid 1,1-Dimethylethyl Ester (B688120). The studies also shown that it can also have potency to act as a novel d-Amino Acid Oxidase (DAO)Inhibitors. |
| | 4-Bromo-2-thiophenecarboxylic acid Preparation Products And Raw materials |
|