- Cbz-D-Phe-OL
-
-
2026-07-07
- CAS:58917-85-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Cbz-D-Phenylalaninol
-
- $30.00
-
2025-06-27
- CAS:58917-85-4
- Min. Order: 50KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | Cbz-D-Phenylalaninol Basic information |
| | Cbz-D-Phenylalaninol Chemical Properties |
| Melting point | 92-95 °C | | alpha | 30 º (c=1 in chloroform) | | Boiling point | 427.77°C (rough estimate) | | density | 1.0864 (rough estimate) | | refractive index | 42 ° (C=2, MeOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | 11.86±0.46(Predicted) | | color | White | | Optical Rotation | [α]22/D +30°, c = 1 in chloroform | | BRN | 2221968 | | Major Application | peptide synthesis | | InChI | 1S/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m1/s1 | | InChIKey | WPOFMMJJCPZPAO-MRXNPFEDSA-N | | SMILES | OC[C@@H](Cc1ccccc1)NC(=O)OCc2ccccc2 | | CAS DataBase Reference | 58917-85-4(CAS DataBase Reference) |
| | Cbz-D-Phenylalaninol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Z-D-Phenylalaninol is used in the synthesis of aminophenylpropanyl phosphate derivatives which has pin1 inhibitory activity. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Cbz-D-Phenylalaninol Preparation Products And Raw materials |
|