|
|
| | Cbz-3-(2-Naphthyl)-D-alanine Basic information |
| | Cbz-3-(2-Naphthyl)-D-alanine Chemical Properties |
| Boiling point | 591.4±50.0 °C(Predicted) | | density | 1.275±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.86±0.30(Predicted) | | color | White to off-white | | BRN | 5829411 | | Major Application | peptide synthesis | | InChI | 1S/C21H19NO4/c23-20(24)19(22-21(25)26-14-15-6-2-1-3-7-15)13-16-10-11-17-8-4-5-9-18(17)12-16/h1-12,19H,13-14H2,(H,22,25)(H,23,24)/t19-/m1/s1 | | InChIKey | XBRPIBMAJOTVHG-LJQANCHMSA-N | | SMILES | OC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)OCc3ccccc3 | | CAS DataBase Reference | 143218-10-4(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Cbz-3-(2-Naphthyl)-D-alanine Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Cbz-3-(2-Naphthyl)-D-alanine Preparation Products And Raw materials |
|