|
|
| | NOSCAPINE HYDROCHLORIDE Basic information |
| Product Name: | NOSCAPINE HYDROCHLORIDE | | Synonyms: | NOSCAPINE HYDROCHLORIDE;NARCOTINE HYDROCHLORIDE;,3-dioxolo(4,5-g)isoquinolin-5-yl)-,hydrochloride,(s-(r*,s*))-;1(3h)isobenzofuranone,6,7-dimethoxy-3-(5,6,7,8-tetrahydro-4-methoxy-6-methyl-1;1-alpha-narcotinehydrochloride;capvalhydrochloride;coscopinhydrochloride;coscotabshydrochloride | | CAS: | 912-60-7 | | MF: | C22H24ClNO7 | | MW: | 449.88 | | EINECS: | 213-014-9 | | Product Categories: | Inhibitors | | Mol File: | 912-60-7.mol |  |
| | NOSCAPINE HYDROCHLORIDE Chemical Properties |
| Melting point | 221-223 °C(lit.) | | storage temp. | 2-8°C | | solubility | Freely soluble in water and in ethanol (96 per cent). Aqueous solutions are slightly acid; the base may be precipitated when the solutions are allowed to stand. | | form | Solid | | color | Crystals | | Merck | 13,6752 | | Major Application | food and beverages | | InChIKey | MFLVZFXCSKVCSH-FSKSRBAZNA-N | | SMILES | C12=C(CCN(C)[C@@]1([H])[C@@]1([H])OC(=O)C3C(OC)=C(OC)C=CC1=3)C=C1OCOC1=C2OC.Cl |&1:6,8,r| | | EPA Substance Registry System | 1(3H)-Isobenzofuranone, 6,7-dimethoxy-3-[(5R)-5,6,7,8-tetrahydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]-, hydrochloride, (3S)- (912-60-7) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22 | | Safety Statements | 36 | | RIDADR | 1544 | | WGK Germany | 3 | | RTECS | NP7225000 | | F | 10 | | HS Code | 2939.19.5000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral STOT SE 3 | | Toxicity | cyt-ham:fbr 60 mg/L ESKHA5 96,55,78 |
| | NOSCAPINE HYDROCHLORIDE Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder or colourless crystals, hygroscopic. | | Uses | topical fluoroquinolone antibiotic for acne | | Uses | Anti-Tussive | | Uses | Noscapine Hydrochloride is a bradykinin B and tubulin inhibitor. Anti-viral. | | Biological Activity | Opioid alkaloid with several actions. Binds to tubulin, arresting cells in mitosis and inducing apoptosis. Also is an antagonist at bradykinin receptors (pA 2 = 6.68), inhibits carbachol-stimulated phosphoinositol turnover and enhances forskolin-stimulated increases in cAMP levels in CNS tissues. Clinically used antitussive agent. | | Safety Profile | Poison by intravenous route.Moderately toxic by ingestion and subcutaneous routes.Mutation data reported. When heated to decomposition itemits very toxic fumes of HCl and NOx. | | in vivo | Noscapine (300mg/kg; oral gavage; daily; for 15 days; athymic female mice) hydrochloride treatment reduces tumor growth in mice[1]. | Animal Model: | Athymic female mice (nu/nu) (8-week-old) injected with rat C6 glioma cells[1] | | Dosage: | 300mg/kg | | Administration: | Oral gavage; daily; for 15 days | | Result: | Revealed a significant reduction of tumor volume.
|
|
| | NOSCAPINE HYDROCHLORIDE Preparation Products And Raw materials |
|