|
|
| | 3-Methoxy-DL-tyrosine Basic information |
| Product Name: | 3-Methoxy-DL-tyrosine | | Synonyms: | rac 3-O-Methyl DOPA;Levodopa Impurity 3 (Levodopa EP Impurity C);2-Amino-3-(4-hydroxy-3-methoxyphenyl);2-AMINO-3-(4-HYDROXY-3-METHOXYPHENYL)PROPANOIC ACID;DL-4-HYDROXY-3-METHOXYPHENYLALANINE;DL-3-O-METHYL-DOPA;3-(4-Hydroxy-3-methoxyphenyl)alanine;3-Methoxy-4-hydroxyphenylalanine | | CAS: | 7636-26-2 | | MF: | C10H13NO4 | | MW: | 211.21 | | EINECS: | | | Product Categories: | 7636-26-2 | | Mol File: | 7636-26-2.mol |  |
| | 3-Methoxy-DL-tyrosine Chemical Properties |
| Melting point | 268 °C (decomp) | | Boiling point | 407.3±45.0 °C(Predicted) | | density | 1.321 | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Aqueous Acid (Slightly), Water (Very Slightly, Heated) | | pka | 2.24±0.20(Predicted) | | form | Solid | | color | White to Beige | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C10H13NO4/c1-15-9-5-6(2-3-8(9)12)4-7(11)10(13)14/h2-3,5,7,12H,4,11H2,1H3,(H,13,14)/t7-/m0/s1 | | InChIKey | PFDUUKDQEHURQC-UHFFFAOYSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(O)C(OC)=C1)N |
| | 3-Methoxy-DL-tyrosine Usage And Synthesis |
| Uses | rac 3-O-Methyl DOPA (Levodopa EP Impurity C) is an impurity of Levodopa (D533751). A useful marker that can be used to screen for the absense of Aromatic L-amino acid decarboxylase (AADC). | | Definition | ChEBI: 3-Methoxytyrosine is a tyrosine derivative. |
| | 3-Methoxy-DL-tyrosine Preparation Products And Raw materials |
|