| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3,4-Dimethoxy-L-phenylalanine Basic information |
| | 3,4-Dimethoxy-L-phenylalanine Chemical Properties |
| Melting point | 254-257 °C(lit.) | | alpha | -5 º (c=4 in 1 M HCl) | | Boiling point | 374.3±42.0 °C(Predicted) | | density | 1.214±0.06 g/cm3(Predicted) | | storage temp. | Store at 0°C | | solubility | Aqueous Acid (Slightly, Heated Sonicated), Aqueous Base (Slightly), Water (Slightly) | | pka | 2.23±0.20(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]22/D 5°, c = 4 in 1 M HCl | | Sensitive | Air Sensitive | | Stability: | Hygroscopic, Temperature Sensitive | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H15NO4/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14/h3-4,6,8H,5,12H2,1-2H3,(H,13,14)/t8-/m0/s1 | | InChIKey | VWTFNYVAFGYEKI-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(OC)C(OC)=C1)N | | CAS DataBase Reference | 32161-30-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37 | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,4-Dimethoxy-L-phenylalanine Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | DOPA intermediate. | | Uses | 3-(3,4-Dimethoxyphenyl)-L-alanine can be used as a reactant to synthesize (2S)-2-amino-3-[3,4-di(methoxy)phenyl]propan-1-ol (β-amino alcohol) for use as a key intermediate to prepare tetracyclic core of the Erythrina alkaloids. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 3,4-Dimethoxy-L-phenylalanine Preparation Products And Raw materials |
|