| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Chloro-3-nitrophenol Basic information |
| | 4-Chloro-3-nitrophenol Chemical Properties |
| Melting point | 125-128 °C (lit.) | | Boiling point | 308.8±27.0 °C(Predicted) | | density | 1.554±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | 7.70±0.10(Predicted) | | color | brown | | BRN | 2094546 | | InChI | 1S/C6H4ClNO3/c7-5-2-1-4(9)3-6(5)8(10)11/h1-3,9H | | InChIKey | JUIKCULGDIZNDI-UHFFFAOYSA-N | | SMILES | Oc1ccc(Cl)c(c1)[N+]([O-])=O | | CAS DataBase Reference | 610-78-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-36/37/381 | | Safety Statements | 26-36-36/37/39 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29089000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Chloro-3-nitrophenol Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 4-Chloro-3-nitrophenol may be used as sole carbon and energy supplement for Pseudomonas sp. JHN. | | General Description | 4-Chloro-3-nitrophenol is a chloronitrophenol, widely used as an important building block for the synthesis of dyes, drugs, explosives and pesticides. Degradation of 4-chloro-3-nitrophenol by Pseudomonas sp. JHN is reported. |
| | 4-Chloro-3-nitrophenol Preparation Products And Raw materials |
|