|
|
| | (R)-1-(4-Methoxyphenyl)ethanol Basic information |
| Product Name: | (R)-1-(4-Methoxyphenyl)ethanol | | Synonyms: | (+)-(R)-1-(4-Methoxyphenyl)ethanol;(alphaR)-4-Methoxy-alpha-methylbenzenemethanol;(R)-1-(4-Methoxyphenyl)ethanol;(R)-1-(p-Methoxyphenyl)ethanol;Benzenemethanol, 4-methoxy-α-methyl-, (αR)-;(R)-(-)-4-methoxy-1-(1-hydroxyethyl)benzene;(R)-alpha-Methyl-4-methoxybenzyl Alcohol | | CAS: | 1517-70-0 | | MF: | C9H12O2 | | MW: | 152.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1517-70-0.mol |  |
| | (R)-1-(4-Methoxyphenyl)ethanol Chemical Properties |
| Boiling point | 254℃ | | density | 1.053 | | Fp | 108℃ | | storage temp. | 2-8°C | | pka | 14.49±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1/C9H12O2/c1-7(10)8-3-5-9(11-2)6-4-8/h3-7,10H,1-2H3/t7-/s3 | | InChIKey | IUUULXXWNYKJSL-KPOCXSGKNA-N | | SMILES | [C@@H](C1C=CC(OC)=CC=1)(O)C |&1:0,r| |
| | (R)-1-(4-Methoxyphenyl)ethanol Usage And Synthesis |
| | (R)-1-(4-Methoxyphenyl)ethanol Preparation Products And Raw materials |
|