|
|
| | 5,6-Dehydro-17β-dutasteride Basic information |
| Product Name: | 5,6-Dehydro-17β-dutasteride | | Synonyms: | 5,6-Dehydro-17β-dutasteride;Dutasteride 17-beta-5-ene;Dutasteride EP Impurity G (Dutasteride 17-beta-5-ene);5,6-Dehydro-172-dutasteride;Dutasteride EP Impurity G;Dutasteride Impurity 15(Dutasteride EP Impurity G);Dutasteride EP Imp G;(1S,3~{a}S,3~{b}S,9~{a}R,9~{b}S,11~{a}S)-N-[2,5-bis(trifluoromethyl)phenyl]-9~{a},11~{a}-dimethyl-7-oxo-1,2,3,3~{a},3~{b},4,6,9~{b},10,11-decahydroindeno[5,4-f]quinoline-1-carboxamide | | CAS: | 1430804-85-5 | | MF: | C27H28F6N2O2 | | MW: | 526.51 | | EINECS: | | | Product Categories: | Inhibitors, Pharmaceuticals, Intermediates & Fine Chemicals, Steroids | | Mol File: | 1430804-85-5.mol |  |
| | 5,6-Dehydro-17β-dutasteride Chemical Properties |
| Melting point | >171°C (dec.) | | Boiling point | 634.9±55.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.32±0.70(Predicted) | | color | White to Off-White | | InChIKey | YBVKJVHUCYJJMX-ULLAOQFFSA-N | | SMILES | N1C2[C@@](C)([C@@]3([H])CC[C@@]4(C)[C@]([H])([C@]3([H])CC=2)CC[C@@H]4C(NC2=CC(C(F)(F)F)=CC=C2C(F)(F)F)=O)C=CC1=O |
| | 5,6-Dehydro-17β-dutasteride Usage And Synthesis |
| Uses | 5,6-Dehydro-17β-dutasteride is an impurity in the synthesis of Dutasteride (D735000), a dual inhibitor of 5α-reductase isoenzymes type 1 and 2; structurally related to Finasteride (F342000). Dutasteride is used in the treatment of benign prostatic hyperplasia. | | Uses | 5,6-Dehydro-dutasteride (Dutateride EP Impurity G) is an impurity in the synthesis of Dutasteride (D735000), a dual inhibitor of 5α-reductase isoenzymes type 1 and 2; structurally related to Finasteride (F342000). Dutasteride is used in the treatment of benign prostatic hyperplasia. |
| | 5,6-Dehydro-17β-dutasteride Preparation Products And Raw materials |
|