|
|
| | 4-Aza-5a-androstan-1-ene-3-one-17b-carboxylic acid Basic information |
| | 4-Aza-5a-androstan-1-ene-3-one-17b-carboxylic acid Chemical Properties |
| Melting point | 295-297 °C | | Boiling point | 527.3±50.0 °C(Predicted) | | density | 1.166 | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) | | pka | 4.80±0.60(Predicted) | | form | Solid | | color | Off-White to Pale Brown | | InChIKey | FDESQZBVTKLIQN-MLGOENBGSA-N | | SMILES | N1[C@@]2([H])[C@@](C)([C@@]3([H])CC[C@@]4(C)[C@]([H])([C@]3([H])CC2)CC[C@@H]4C(O)=O)C=CC1=O |
| | 4-Aza-5a-androstan-1-ene-3-one-17b-carboxylic acid Usage And Synthesis |
| Chemical Properties | 4-Aza-5a-androstan-1-ene-3-one-17b-carboxylic acid is Off-White Powder | | Uses | 4-Aza-5a-androstan-1-ene-3-one-17b-carboxylic acid is an intermediate in the synthesis of Finasteride, am onhibitor of 5a-reductase, the enzyme which converts testosterone to the more potent androgen, 5a-dihydrotestosterone | | Uses | A novel intermediate in the synthesis of Finasteride, a 5α-reductase inhibitor used for treatment of benign prostatic hyperplasia acne, seborrhea, female hirsutism, prostatitis, and prostatic carcinoma and other hyperandrogenetic related disorders. | | Uses | A novel intermediate in the synthesis of Finasteride and Dutasteride, a 5α-reductase inhibitors used for treatment of benign prostatic hyperplasia acne, seborrhea, female hirsutism, prostatitis, and p
rostatic carcinoma and other hyperandrogenetic related disorders. |
| | 4-Aza-5a-androstan-1-ene-3-one-17b-carboxylic acid Preparation Products And Raw materials |
| Raw materials | 1H-Benz[e]indene-6-propanoic acid, 3-acetyldodecahydro-3a,6-dimethyl-7-oxo-, (3S,3aS,5aS,6R,9aS,9bS)--->1416955-18-4-->2H-Indeno[5,4-f]quinolin-2-one, 7-acetyl-1,3,4,4a,4b,5,6,6a,7,8,9,9a,9b,10-tetradecahydro-4a,6a-dimethyl-, (4aR,4bS,6aS,7S,9aS,9bS)--->1H-Benz[e]indene-6-propanamide, 3-acetyldodecahydro-3a,6-dimethyl-7-oxo-, (3S,3aS,5aS,6R,9aS,9bS)--->2H-Indeno[5,4-f]quinolin-2-one, 7-acetylhexadecahydro-4a,6a-dimethyl-, (4aR,4bS,6aS,7S,9aS,9bS,11aR)--->Bis(trimethylsilyl) sulfate-->Methyl 4-aza-5alpha-androsta-3-one-17beta-carboxylate-->Methyl 4-aza-5alpha-androsta-1-en-3-one-17beta-carboxylate-->3-Oxo-4-aza-5-alpha-androstane-17-beta-carboxylic acid-->Dichloromethane-->Methanol-->1,3-Cyclohexanedione |
|