|
|
| | 4-Nitronaphthalene-1,8-dicarboxylic anhydride Basic information |
| Product Name: | 4-Nitronaphthalene-1,8-dicarboxylic anhydride | | Synonyms: | 4-NITRONAPHTHALENE-1,8-DICARBOXYLIC ANHYDRIDE;4-NITRO-1,8-NAPHTHALIC ANHYDRIDE;4-NITRO-1,8-NAPHTHALIC ANHYDRIDE 95+%;1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 4-nitro-;6-nitrobenzo[de]isochroMene-1,3-dione;4-Nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione;4-Nitrophthalene-1,8-dicarboxylic anhydride;4-Nitrobenzo[de]isochromene-1,3-dione | | CAS: | 34087-02-0 | | MF: | C12H5NO5 | | MW: | 243.17 | | EINECS: | | | Product Categories: | Intermediates of Dyes and Pigments;Phthalic Acids, Esters and Derivatives | | Mol File: | 34087-02-0.mol |  |
| | 4-Nitronaphthalene-1,8-dicarboxylic anhydride Chemical Properties |
| Melting point | 226-229 °C(lit.) | | Boiling point | 512.9±33.0 °C(Predicted) | | density | 1.637±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Yellow to orange Solid | | InChI | InChI=1S/C12H5NO5/c14-11-7-3-1-2-6-4-5-8(13(16)17)10(9(6)7)12(15)18-11/h1-5H | | InChIKey | QLYSDTXUBZEOII-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)C2=C([N+]([O-])=O)C=CC3=C2C1=CC=C3 | | CAS DataBase Reference | 34087-02-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 9-21 | | Hazard Note | Irritant |
| | 4-Nitronaphthalene-1,8-dicarboxylic anhydride Usage And Synthesis |
| Chemical Properties | light yellow powder |
| | 4-Nitronaphthalene-1,8-dicarboxylic anhydride Preparation Products And Raw materials |
|