| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Methyl 3-amino-5,6-dichloro-2-pyrazinecarboxylate Basic information |
| Product Name: | Methyl 3-amino-5,6-dichloro-2-pyrazinecarboxylate | | Synonyms: | TIMTEC-BB SBB003342;3-Amino-5,6-Dichloropyrazine-2-Carboxylic Acid Methyl Ester;methyl 3-amino-5,6-dichloro-2-pyrazine-carboxylat;3-Amino-5,6-dichloro-2-pyrazinecarboxylic acid methyl ester;METHYL 3-AMINO-5 6-DICHLORO-2-PYRAZINE-&;Pyrazinecarboxylic acid, 3-amino-5,6-dichloro-, methyl ester;2-Pyrazinecarboxylic acid, 3-aMino-5,6-dichloro-, Methyl ester;Methyl 3-amino-5,6-dichloro-2-pyrazinecarboxylate,98% | | CAS: | 1458-18-0 | | MF: | C6H5Cl2N3O2 | | MW: | 222.03 | | EINECS: | 215-947-7 | | Product Categories: | M;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 1458-18-0.mol |  |
| | Methyl 3-amino-5,6-dichloro-2-pyrazinecarboxylate Chemical Properties |
| Melting point | 227-230 °C | | Boiling point | 357.3±37.0 °C(Predicted) | | density | 1.586 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly) | | pka | -2.74±0.10(Predicted) | | form | Powder | | color | Light brown to red-brown | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | InChI=1S/C6H5Cl2N3O2/c1-13-6(12)2-5(9)11-4(8)3(7)10-2/h1H3,(H2,9,11) | | InChIKey | USYMCUGEGUFUBI-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC(Cl)=C(Cl)N=C1N | | LogP | 1.9-2.2 at 35℃ | | CAS DataBase Reference | 1458-18-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-20/22-20 | | Safety Statements | 36/37/39-26-22-45 | | WGK Germany | 3 | | Hazard Note | Harmful | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | Methyl 3-amino-5,6-dichloro-2-pyrazinecarboxylate Usage And Synthesis |
| Chemical Properties | light brown to red-brown powder | | Uses | 3-Amino-5,6-dichloro-2-pyrazinecarboxylic Acid Methyl Ester, is used for the preparation of 2-Amidino analogs of glycine-Amiloride (A578700) conjugates, acting as inhibitors of the protease urokinase plasminogen activator (uPA), a promising anticancer targets. Dyes and metabolites. |
| | Methyl 3-amino-5,6-dichloro-2-pyrazinecarboxylate Preparation Products And Raw materials |
|