| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | PROSTAGLANDIN A2 Basic information |
| | PROSTAGLANDIN A2 Chemical Properties |
| Boiling point | 391.24°C (rough estimate) | | density | 1.0332 (rough estimate) | | refractive index | 1.4434 (estimate) | | Fp | -9 °C | | storage temp. | −20°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Water (Slightly) | | form | Neat oil. | | pka | 4.75±0.10(Predicted) | | color | Colourless to Dark Yellow | | biological source | synthetic | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | InChI | 1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12-18,21H,2-3,5-6,8-11H2,1H3,(H,23,24)/b7-4-,14-12+/t16-,17-,18+/m0/s1 | | InChIKey | MYHXHCUNDDAEOZ-FOSBLDSVSA-N | | SMILES | CCCCC[C@H](O)\C=C\[C@H]1C=CC(=O)[C@@H]1C\C=C/CCCC(O)=O |
| Hazard Codes | F,Xi | | Risk Statements | 11-36-66-67 | | Safety Statements | 26-16 | | RIDADR | UN 1231 3/PG 2 | | WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Oral
Repr. 2 |
| | PROSTAGLANDIN A2 Usage And Synthesis |
| Uses | Prostaglandin A2 is a naturally occurring prostaglandin in gorgonian corals where it may function in self defense. Prostaglandin A2 is generally not present in mammals. Prostaglandin A2 has low biological potency in most bioassays, but it does show some antiviral/antitumor activity. Prostaglandin A2 has also been shown to act as a vasodilator with natriuretic properties. | | Definition | ChEBI: Prostaglandin A2 is a prostaglandins A. It has a role as a human metabolite. It is a conjugate acid of a prostaglandin A2(1-). | | IC 50 | Human Endogenous Metabolite |
| | PROSTAGLANDIN A2 Preparation Products And Raw materials |
|