|
|
| | Diethyl isopropylidenemalonate Basic information |
| | Diethyl isopropylidenemalonate Chemical Properties |
| Melting point | 93-94 °C | | Boiling point | 175-178 °C/120 mmHg (lit.) | | density | 1.021 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.451(lit.) | | Fp | 229 °F | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.021 | | λmax | 214nm(EtOH)(lit.) | | BRN | 1776122 | | InChI | 1S/C10H16O4/c1-5-13-9(11)8(7(3)4)10(12)14-6-2/h5-6H2,1-4H3 | | InChIKey | WEISAZNMMVPNTH-UHFFFAOYSA-N | | SMILES | CCOC(=O)\C(=C(/C)C)C(=O)OCC | | CAS DataBase Reference | 6802-75-1(CAS DataBase Reference) | | NIST Chemistry Reference | Diethyl isopropylidenemalonate(6802-75-1) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 29171900 | | Storage Class | 10 - Combustible liquids |
| | Diethyl isopropylidenemalonate Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | Diethyl isopropylidenemalonate has been used in the synthesis of retinoids having functional groups at the side-chain terminus. | | General Description | Reduction of diethyl isopropylidenemalonate with sodium borohydride has been reported. |
| | Diethyl isopropylidenemalonate Preparation Products And Raw materials |
|