|
|
| | LC-LC(+)-Biotin Basic information |
| Product Name: | LC-LC(+)-Biotin | | Synonyms: | LC-LC(+)-Biotin;6-[[6-[[5-[(3aS,4S,6aR)-Hexahydro-2-oxo-1H-thieno[3,4-d]iMidazol-4-yl]-1-oxopentyl]aMino]-1-oxohexyl]aMino]hexanoic Acid;Biotin-XX, Free Acid [6-((6-((Biotinoyl)Amino)Hexanoyl)amino) Hexanoic Acid];LC-LC-(+)-BIOTIN 1G;Biotin-XX, 95%;Biotin-C5-amino-C5-amino;Hexanoic acid, 6-[[6-[[5-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]amino]-1-oxohexyl]amino]-;N-Biotinylaminocaproylaminocaproic Acid | | CAS: | 89889-51-0 | | MF: | C22H38N4O5S | | MW: | 470.63 | | EINECS: | | | Product Categories: | Biotin Derivatives;Cross Linking Reagents | | Mol File: | 89889-51-0.mol |  |
| | LC-LC(+)-Biotin Chemical Properties |
| Melting point | 185-195°C | | Boiling point | 857.3±65.0 °C(Predicted) | | density | 1.168±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | soluble in DMF, DMSO | | form | Solid | | pka | 4.75±0.10(Predicted) | | color | White | | Stability: | Moisture Sensitive | | InChIKey | SRKRKWYAHKIBEW-FIKGOQFSSA-N | | SMILES | C(O)(=O)CCCCCNC(=O)CCCCCNC(=O)CCCC[C@H]1[C@@]2([H])NC(=O)N[C@@]2([H])CS1 |
| | LC-LC(+)-Biotin Usage And Synthesis |
| Description | Biotin-LC-LC is a heterobiofunctional biotin PEG linker containing a carboxylic acid group. The extended spacer arm helps to minimize steric hindrance. With its uncharged, simple alkyl-chain spacer arm, this biotin compound is membrane-permeable and useful for intracellular labeling. | | Chemical Properties | White Solid | | Uses | A biotinylated cross-linking reagent. | | IC 50 | Alkyl-Chain |
| | LC-LC(+)-Biotin Preparation Products And Raw materials |
|