| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Metoprolol EP IMpurity M Basic information |
| Product Name: | Metoprolol EP IMpurity M | | Synonyms: | Metoprolol EP IMpurity M;1,3-bis(propan-2-ylamino)propan-2-ol;1,3-bis(isopropylamino)propan-2-ol;Metoprolol Impurity M;2-Propanol, 1,3-bis[(1-methylethyl)amino]-;1,3-Bis[(1-methylethyl)amino]-2-propanol;13/5000 Metoprolol tartrate impurity M;Metoprolol Impurity 30 | | CAS: | 343785-33-1 | | MF: | C9H22N2O | | MW: | 174.28 | | EINECS: | | | Product Categories: | | | Mol File: | 343785-33-1.mol |  |
| | Metoprolol EP IMpurity M Chemical Properties |
| Boiling point | 268.0±25.0 °C(Predicted) | | density | 0.901±0.06 g/cm3(Predicted) | | pka | 14.41±0.20(Predicted) | | InChI | InChI=1S/C9H22N2O/c1-7(2)10-5-9(12)6-11-8(3)4/h7-12H,5-6H2,1-4H3 | | InChIKey | KUKNLWUAKYIWDI-UHFFFAOYSA-N | | SMILES | C(NC(C)C)C(O)CNC(C)C |
| | Metoprolol EP IMpurity M Usage And Synthesis |
| Uses | 1,3-Bis[(1-methylethyl)amino]-2-propanol (Metoprolol EP Impurity M) is an impurity of Metoprolol (M338790), a β1 selective aryloxypropanolamine andrenergic antagonist which ois used in the treatment of a variety of cardiovascular disorder (1,2). Antihypertensive; antianginal; antiarrhythmic (class II). |
| | Metoprolol EP IMpurity M Preparation Products And Raw materials |
|