|
|
| | Methanesulfonato(tricyclohexylphosphine)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct Basic information | | Appearance Uses |
| Product Name: | Methanesulfonato(tricyclohexylphosphine)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct | | Synonyms: | Methanesulfonato(tricyclohexylphosphine)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct, Min. 98%;Methanesulfonato(tricyclohexylphosphine)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) dichloromethane adduct, min. 98% [PCy3 Palladacycle Gen. 3];PCY3 PALLADACYCLE GEN. 3;Methanesulfonato(tricyclohexylphosphine)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) dichloromethane adduct,[PCy3 Palladacycle Gen. 3];Methanesulfonato(tricyclohexylphosphine)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct;Methanesulfonato(tricyclohexylphosphine)(2'-amino-1,1'-biphenyl-2-yl)palladium(II) / PCy3 Pd G3;Methanesulfonato [(±)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthalene] (2'-amino-1,1'-biphenyl-2-yl)palladium(II);Methanesulfonato(tricyclohexylphosphine)(2-aMino-1 | | CAS: | 1445086-12-3 | | MF: | C31H46NO3PPdS | | MW: | 650.16 | | EINECS: | | | Product Categories: | Buchwald Ligands&Precatalysts;Buchwald Precatalysts Series;Pd | | Mol File: | 1445086-12-3.mol |  |
| | Methanesulfonato(tricyclohexylphosphine)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct Chemical Properties |
| Melting point | 219-224 °C (decomposition) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Powder | | color | off-white to beige | | InChIKey | DXWSVUBOOZZYRY-UHFFFAOYSA-N | | SMILES | CS(=O)(=O)O[Pd]c1ccccc1-c2ccccc2N.C3CCC(CC3)P(C4CCCCC4)C5CCCCC5 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Methanesulfonato(tricyclohexylphosphine)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct Usage And Synthesis |
| Appearance | off-white to beige powder | | Uses | A new palladium precatalyst for C-C and C-N cross-coupling reactions.
| | Uses | P(Cy3) Pd G3 is a 3rd generation phosphine functionalized palladium precatalyst used in organic synthesize, that is often used in cross-coupling reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings |
| | Methanesulfonato(tricyclohexylphosphine)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) dichloroMethane adduct Preparation Products And Raw materials |
|