- 1,3-DIISOPROPYLBENZENE
-
- $6.00 / 1kg
-
2025-07-29
- CAS:99-62-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000KG/Month
- 1,3-DIISOPROPYLBENZENE
-
- $10.00 / 1kg
-
2024-04-24
- CAS:99-62-7
- Min. Order: 1kg
- Purity: 99.6%
- Supply Ability: 100000
|
| | 1,3-DIISOPROPYLBENZENE Basic information |
| Product Name: | 1,3-DIISOPROPYLBENZENE | | Synonyms: | 1,3-bis(1-methylethyl)-benzen;1,3-bis(1-methylethyl)benzene;1,3-bis(1-methylethyl)-Benzene;Benzene, 1,3-di-(1-methylethyl);3-Diisopropylbenzene;C12 H18, fx 1,3-bis(methylethyl)-benzene 99-62-7 / 98-19-1;1,3-Diisopropylbenzene,96%;Benzene, 1,3-bis(1-methylethyl)- | | CAS: | 99-62-7 | | MF: | C12H18 | | MW: | 162.27 | | EINECS: | 202-773-1 | | Product Categories: | Bioactive Small Molecules;Building Blocks;Cell Biology;Chemical Synthesis;DIG-DY;Organic Building Blocks;Arenes | | Mol File: | 99-62-7.mol |  |
| | 1,3-DIISOPROPYLBENZENE Chemical Properties |
| Melting point | -63 °C (lit.) | | Boiling point | 203 °C (lit.) | | density | 0.856 g/mL at 25 °C (lit.) | | vapor pressure | 9.97Pa at 20℃ | | refractive index | n20/D 1.488(lit.) | | Fp | 170 °F | | storage temp. | Store at room temperature, keep dry and cool | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | Soluble in water 4.33 mg/L at 25°C. | | BRN | 1905828 | | Henry's Law Constant | 9.5×10-4 mol/(m3Pa) at 25℃, Yaws (2003) | | InChI | InChI=1S/C12H18/c1-9(2)11-6-5-7-12(8-11)10(3)4/h5-10H,1-4H3 | | InChIKey | UNEATYXSUBPPKP-UHFFFAOYSA-N | | SMILES | C1(C(C)C)=CC=CC(C(C)C)=C1 | | LogP | 5.13 at 25℃ | | CAS DataBase Reference | 99-62-7(CAS DataBase Reference) | | EPA Substance Registry System | m-Diisopropylbenzene (99-62-7) |
| Risk Statements | 33 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | RTECS | CZ6334000 | | Autoignition Temperature | 840 °F | | TSCA | TSCA listed | | HS Code | 2902.90.9000 | | HazardClass | 9 | | PackingGroup | III | | Storage Class | 10 - Combustible liquids | | Hazardous Substances Data | 99-62-7(Hazardous Substances Data) |
| | 1,3-DIISOPROPYLBENZENE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 1,3-Diisopropylbenzene was used in the synthesis of benzene-1,3,5-triphosphonic acid. | | Definition | ChEBI: 1,3-Diisopropylbenzene is an alkylbenzene. | | General Description | 1,3-Diisopropylbenzene undergoes anodic oxidation in methanol to yield dimethoxy-functionalized product. | | Flammability and Explosibility | Non flammable |
| | 1,3-DIISOPROPYLBENZENE Preparation Products And Raw materials |
|