|
|
| | Perflurohexane sulphonyl fluoride Basic information |
| Product Name: | Perflurohexane sulphonyl fluoride | | Synonyms: | (2R,3R,4S,5S,6R)-2-[[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)-2-oxolanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonylfluorid;PERFLUOROHEXANESULFONYL FLUORIDE;PERFLUOROHEXANESULPHONYL FLUORIDE;Perflurohexane sulphonyl fluoride;TRIDECAFLUOROHEXANESULFONYL FLUORIDE;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonyl fluoride;1-Hexanesulfonyl fluoride, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro- | | CAS: | 423-50-7 | | MF: | C6F14O2S | | MW: | 402.11 | | EINECS: | 207-026-3 | | Product Categories: | | | Mol File: | 423-50-7.mol |  |
| | Perflurohexane sulphonyl fluoride Chemical Properties |
| Boiling point | 114-115 °C | | density | 1.785±0.06 g/cm3(Predicted) | | solubility | Benzene (Sparingly), Methanol (Slightly) | | form | liquid | | color | Clear | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C6F14O2S/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22 | | InChIKey | HSDJWNJDPDJOEV-UHFFFAOYSA-N | | SMILES | C(F)(F)(S(F)(=O)=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 423-50-7(CAS DataBase Reference) | | EPA Substance Registry System | 1-Hexanesulfonyl fluoride, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro- (423-50-7) |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 26-36/37/39 | | RIDADR | 3265 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HS Code | 2904990090 |
| | Perflurohexane sulphonyl fluoride Usage And Synthesis |
| Uses | Perfluorohexane Sulphonyl Fluoride (>80%) is a useful compound for preparing acrylic pressure-sensitive adhesive tape. |
| | Perflurohexane sulphonyl fluoride Preparation Products And Raw materials |
|