- Fmoc-D-Cys(trt)-OH
-
-
2026-08-21
- CAS:167015-11-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | N-Fmoc-S-trityl-D-cysteine Basic information |
| | N-Fmoc-S-trityl-D-cysteine Chemical Properties |
| Melting point | 172-176℃ | | Boiling point | 763.4±60.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Tetrahydrofuran | | pka | 3.70±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Major Application | peptide synthesis | | InChIKey | KLBPUVPNPAJWHZ-UUWRZZSWSA-N | | SMILES | C(O)(=O)[C@@H](CSC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 167015-11-4(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2930 90 16 | | Storage Class | 11 - Combustible Solids |
| | N-Fmoc-S-trityl-D-cysteine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-S-(triphenylmethyl)-D-cysteine is a reagent in the identification and preparation of plasma-stable cyclic peptides as novel, potent C-X-C chemokine receptor type 4 antagonists with antitumor potential. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | N-Fmoc-S-trityl-D-cysteine Preparation Products And Raw materials |
|