| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Methyl 3-bromo-2-(bromomethyl)propionate Basic information | | Uses |
| Product Name: | Methyl 3-bromo-2-(bromomethyl)propionate | | Synonyms: | Methyl 3-bromo-2-(bromomethyl)propionate 98%;3-Bromo-2-(bromomethyl)-propionic acid methyl ester;Methyl 3-bromo-2-(bromomethyl)propionate,97%;Methyl bis(bromomethyl)acetate;Methyl 2-bis-(bromomethyl)-acetate;Methyl 3-broMo-2-(broMoMethyl)propionate, 97% 5GR;3-Bromo-2-(bromomethyl)propionic Acid Methyl Ester
Methyl beta,beta'-Dibromoisobutyrate
Methyl Bis(bromomethyl)acetate;Propanoic acid, 3-broMo-2-(broMoMethyl)-, Methyl ester | | CAS: | 22262-60-8 | | MF: | C5H8Br2O2 | | MW: | 259.92 | | EINECS: | | | Product Categories: | C2 to C5;Carbonyl Compounds;Esters | | Mol File: | 22262-60-8.mol |  |
| | Methyl 3-bromo-2-(bromomethyl)propionate Chemical Properties |
| Boiling point | 60-62 °C/0.4 mmHg (lit.) | | density | 1.82 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.508(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light red to Green | | Specific Gravity | 1.82 | | InChI | InChI=1S/C5H8Br2O2/c1-9-5(8)4(2-6)3-7/h4H,2-3H2,1H3 | | InChIKey | USXVPPOARMSYGY-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(CBr)CBr |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29159000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Methyl 3-bromo-2-(bromomethyl)propionate Usage And Synthesis |
| Uses | methyl 3-bromo-2-(bromomethyl)propanoate is a useful research chemical. | | Chemical Properties | clear colorless to yellow liquid | | Uses | Methyl 3-bromo-2-(bromomethyl)propionate was used in synthesis of sultams and (S)-1-benzyl-3-hydroxypyrrolidine. |
| | Methyl 3-bromo-2-(bromomethyl)propionate Preparation Products And Raw materials |
|