- FMOC-NVA-OH
-
- $15.00 / 1KG
-
2021-08-12
- CAS:135112-28-6
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- FMOC-NVA-OH
-
- $1.00 / 1KG
-
2019-07-12
- CAS:135112-28-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 25kg
|
| | N-FMoc-L-norvaline Basic information |
| | N-FMoc-L-norvaline Chemical Properties |
| Melting point | 151-155 °C | | Boiling point | 557.9±33.0 °C(Predicted) | | density | 1.230±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.91±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 21±1°, c = 2% in DMF | | BRN | 5883879 | | Major Application | peptide synthesis | | InChI | 1S/C20H21NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h3-6,8-11,17-18H,2,7,12H2,1H3,(H,21,24)(H,22,23)/t18-/m0/s1 | | InChIKey | JBIJSEUVWWLFGV-SFHVURJKSA-N | | SMILES | N([C@@H](CCC)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 | | CAS DataBase Reference | 135112-28-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | N-FMoc-L-norvaline Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-nva-oh is a tumor targeting Polypeptide and its application in preparation of Polypeptide drug conjugate. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | N-FMoc-L-norvaline Preparation Products And Raw materials |
|