- Fmoc-L-Tyr(bzl)-oh
-
-
2026-06-12
- CAS:71989-40-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Fmoc-O-benzyl-L-tyrosine Basic information |
| | Fmoc-O-benzyl-L-tyrosine Chemical Properties |
| Melting point | 157-161 °C | | Boiling point | 719.7±60.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 2.96±0.10(Predicted) | | color | White to off-white | | Optical Rotation | [α]20/D 16.0±2.5°, c = 1% in DMF | | BRN | 4341195 | | Major Application | peptide synthesis | | InChIKey | REHSJSKPWIOKIJ-LJAQVGFWSA-N | | SMILES | OC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)OCC3c4ccccc4-c5ccccc35 | | CAS DataBase Reference | 71989-40-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | Fmoc-O-benzyl-L-tyrosine Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis |
| | Fmoc-O-benzyl-L-tyrosine Preparation Products And Raw materials |
|