| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- Propargyl-PEG5-PA
-
-
2026-07-24
- CAS:1245823-51-1
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | Acetylene-PEG5-acid Basic information |
| Product Name: | Acetylene-PEG5-acid | | Synonyms: | Propyne-PEG4-CH2CH2COOH;Alkyne-PEG4-Acid;Alkyne-PEG5-COOH;PROPARGYL-PEG5-COOH;Propargyl-PEG4-CH2CH2COOH;Acetylene-PEG5-acid;Alkyne-PEG5-acid;Propargyl-PEG5-acid | | CAS: | 1245823-51-1 | | MF: | C14H24O7 | | MW: | 304.34 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1245823-51-1.mol |  |
| | Acetylene-PEG5-acid Chemical Properties |
| Boiling point | 426.3±45.0 °C(Predicted) | | density | 1.127±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | pka | 4.28±0.10(Predicted) | | form | Liquid | | color | Light yellow to yellow | | Appearance | yellow oily liquid | | InChI | InChI=1S/C14H24O7/c1-2-4-17-6-8-19-10-12-21-13-11-20-9-7-18-5-3-14(15)16/h1H,3-13H2,(H,15,16) | | InChIKey | GWIACWQVTBMVEI-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCC#C |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 |
| | Acetylene-PEG5-acid Usage And Synthesis |
| Description | Propargyl-PEG5-acid has a propargyl group at one end and an acid group at the other end. The acid can react with primary amines to form a stable amide bond, activation will be needed. The PEG units enhances solubility of the molecule in aqueous environment. The propargyl group can be linked to azide-containing biomolecules via Click Chemistry. | | Uses | Propargyl-peg5 Acid is used as a reactant in the preparation of site-specific antibody-pyrrolobenzodiazepine conjugates. | | Uses | Alkyne-PEG5-acid may be used in the synthesis of peptide nucleic acid (PNA) oligomers that can conjugate with vitamin B12 via Cu-catalyzed 1,3-dipolar cycloaddition in order to study if vitamin B12 to transport PNA oligonucleotides into bacterial cells. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | Non-cleavable Linker; PEGs |
| | Acetylene-PEG5-acid Preparation Products And Raw materials |
|