|
|
| | 3-Ethoxy-4-methoxybenzaldehyde Basic information |
| | 3-Ethoxy-4-methoxybenzaldehyde Chemical Properties |
| Melting point | 51 °C | | Boiling point | 155°C/10mmHg(lit.) | | density | 1.088±0.06 g/cm3(Predicted) | | Fp | 113 °C | | storage temp. | room temp | | solubility | Soluble in methanol. | | form | powder to crystal | | color | White to Orange to Green | | Sensitive | Air Sensitive | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | InChI=1S/C10H12O3/c1-3-13-10-6-8(7-11)4-5-9(10)12-2/h4-7H,3H2,1-2H3 | | InChIKey | VAMZHXWLGRQSJS-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(OC)C(OCC)=C1 | | CAS DataBase Reference | 1131-52-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 23-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29124990 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 3-Ethoxy-4-methoxybenzaldehyde Usage And Synthesis |
| Chemical Properties | Colorless solid | | Uses | 3-Ethoxy-4-methoxybenzaldehyde is used as a pharmaceutical intermediate. | | Application | 3-Ethoxy-4-methoxybenzaldehyde may be used to synthesize Compound of
Designation red 10 binding (CDr10b) to investigate its role in
neuroinflammatory diseases. | | Synthesis | In a 3 L dry reaction flask, 157 g of sodium hydroxide was dissolved in 1500 ml of water, 500 g of isovanillin, 120 g of tetrabutylammonium fluoride, and 537 g of ethyl bromide were added, and the reaction was stirred at 25°C for 4 hours. After filtration by suction, an off-white solid powder of 3-ethoxy-4-methoxybenzaldehyde was obtained with a purity of 99.9% and a yield of 96.1%. | | General Description | 3-Ethoxy-4-methoxybenzaldehyde is a derivative of vanillin. | | References | [1] Patent: CN107827722, 2018, A. Location in patent: Paragraph 0034-0041 |
| | 3-Ethoxy-4-methoxybenzaldehyde Preparation Products And Raw materials |
|