- Aminexil
-
- $1.00
-
2026-09-17
- CAS:74638-76-9
- Min. Order: 300g
- Purity: 99.8%
- Supply Ability: 20 TONS
- Kopexil
-
- $3.00
-
2026-08-25
- CAS:74638-76-9
- Purity: 99%
|
| | 2,4-Diamino pyrimidine-3-oxide Basic information |
| Product Name: | 2,4-Diamino pyrimidine-3-oxide | | Synonyms: | 2,4-Pyrimidinediamine, 3-oxide (9CI);2,4-Diaminopyrimidine 3-N-oxide;2,4-DIAMINO PYRIMIDINE-3-OXIDE;2,4-DIAMINO PYRIMIDINE-3-OXIDE ISO 9001：2015 REACH;Minoxidil Impurity 8;2,4-DIAMINO PYRIMIDINE-N-OXIDE;Mexoryl SAG;Kopexil/Aminexil | | CAS: | 74638-76-9 | | MF: | C4H6N4O | | MW: | 126.12 | | EINECS: | 616-121-2 | | Product Categories: | PYRIMIDINE;john's | | Mol File: | 74638-76-9.mol |  |
| | 2,4-Diamino pyrimidine-3-oxide Chemical Properties |
| Boiling point | 475.5±37.0 °C(Predicted) | | density | 1.69±0.1 g/cm3(Predicted) | | pka | 5.04±0.47(Predicted) | | Cosmetics Ingredients Functions | HAIR CONDITIONING
SKIN CONDITIONING | | InChI | InChI=1S/C4H6N4O/c5-3-1-2-7-4(6)8(3)9/h1-2H,5H2,(H2,6,7) | | InChIKey | SGHQFNHCCOBUKB-UHFFFAOYSA-N | | SMILES | C1(N)=NC=CC(N)=[N+]1[O-] |
| | 2,4-Diamino pyrimidine-3-oxide Usage And Synthesis |
| Uses | 2,4-Diamino pyrimidine-3-oxide is a valuable organic synthetic reagent for preparing pyrimidines and in making hair loss and skin care compositions. It is used in hair care formulations to prevent increased hair loss. |
| | 2,4-Diamino pyrimidine-3-oxide Preparation Products And Raw materials |
|