- Boc-L-alaninal
-
- $2.00
-
2020-01-10
- CAS:79069-50-4
- Min. Order: 1g
- Purity: 98%MIN
|
| | Boc-L-alaninal Basic information |
| | Boc-L-alaninal Chemical Properties |
| Melting point | 76-77 °C | | Boiling point | 248.5±23.0 °C(Predicted) | | density | 1.015±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | soluble in Methanol | | pka | 11.43±0.46(Predicted) | | form | Powder | | color | White to yellow | | InChI | InChI=1S/C8H15NO3/c1-6(5-10)9-7(11)12-8(2,3)4/h5-6H,1-4H3,(H,9,11)/t6-/m0/s1 | | InChIKey | OEQRZPWMXXJEKU-LURJTMIESA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H](C)C=O |
| WGK Germany | 3 | | HS Code | 2924297099 |
| | Boc-L-alaninal Usage And Synthesis |
| Chemical Properties | White to light yellow powder | | Uses | Boc-L-alaninal is used as a reagent for organic synthesis of C(26)-C(32) Oxazole Fragment of Calyculin C and other molecules. |
| | Boc-L-alaninal Preparation Products And Raw materials |
|