|
|
| | 5-Chlorobenzotriazole Basic information |
| | 5-Chlorobenzotriazole Chemical Properties |
| Melting point | 157-159 °C (lit.) | | Boiling point | 252.42°C (rough estimate) | | density | 1.3647 (rough estimate) | | refractive index | 1.7200 (estimate) | | storage temp. | 2-8°C, protect from light | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 7.46±0.40(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | Water Solubility | SOLUBLE IN HOT WATER | | InChI | InChI=1S/C6H4ClN3/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,8,9,10) | | InChIKey | PZBQVZFITSVHAW-UHFFFAOYSA-N | | SMILES | N1C2=CC(Cl)=CC=C2N=N1 | | CAS DataBase Reference | 94-97-3(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Benzotriazole, 5-chloro- (94-97-3) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 5-Chlorobenzotriazole Usage And Synthesis |
| Chemical Properties | OFF-WHITE POWDER | | Uses | 5-Chlorobenzotriazole is a good inhibitor; it decreases anodic and cathodic reaction rates, and the highest inhibition efficiency was 91.2%. The inhibitory effect of 5-chlorobenzotriazole is explained by the formation of the layer on the copper surface. | | Preparation | 4-Chloro-2-nitroaniline is used as raw material to produce 4-chloro-1,2-phenylenediamine by reduction of iron powder in acidic medium, and the latter is diazotized and cyclized to obtain 5-chlorobenzotriazole. The yield is 78%. |
| | 5-Chlorobenzotriazole Preparation Products And Raw materials |
|