| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Fmoc-D-proline
-
-
2026-09-18
- CAS:101555-62-8
- Min. Order: 1kg
- Purity: 99%min HPLC
- Supply Ability: 100kg
- Fmoc-D-proline
-
- $1.00
-
2019-07-06
- CAS:101555-62-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | Fmoc-D-proline Basic information |
| | Fmoc-D-proline Chemical Properties |
| Melting point | 110-116°C | | Boiling point | 548.6±43.0 °C(Predicted) | | density | 1.328±0.06 g/cm3(Predicted) | | refractive index | 32 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder to crystal | | pka | 3.95±0.20(Predicted) | | color | White to Light yellow | | Optical Rotation | [α]/D +31.0±3.0°, c = 1 in DMF | | BRN | 5856698 | | Major Application | peptide synthesis | | InChI | InChI=1S/C20H19NO4/c22-19(23)18-10-5-11-21(18)20(24)25-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17-18H,5,10-12H2,(H,22,23)/t18-/m1/s1 | | InChIKey | ZPGDWQNBZYOZTI-GOSISDBHSA-N | | SMILES | N1(C(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)CCC[C@@H]1C(O)=O | | CAS DataBase Reference | 101555-62-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2933 99 80 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-D-proline Usage And Synthesis |
| Chemical Properties | White powder | | Uses | In organic synthesis, N-Fmoc-D-proline are often employed as important intermediates in various areas such as peptide synthesis, asymmetric synthesis, medicinal chemistry, and polymer chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis | | Synthesis | D-proline was added to a round-bottomed flask, 10% aqueous sodium carbonate was added and stirred to dissolve, then dioxane was added, and a 10% dioxane solution of 9-fluorenylmethoxycarbonyl chloride was slowly added dropwise into the reaction solution under an ice bath, and after the dropwise addition was completed the reaction was carried out in an ice bath for 2 hours, and then at room temperature for 8 hours, and the reaction was diluted with the addition of water, and the extract was carried out with ether
4
times, the aqueous layer was placed in an ice bath, the pH was adjusted with concentrated hydrochloric acid until the Congo red paper showed blue, placed in a refrigerator overnight, the white precipitate was extracted with ethyl acetate, the combined organic solution was washed with water, the organic layer was dried with anhydrous magnesium sulphate, and the product FMOC-D-proline was obtained by pumping dry. |
| | Fmoc-D-proline Preparation Products And Raw materials |
|