| Company Name: |
Gold |
| Tel: |
19011298796 19011298796 |
| Email: |
17816380947@139.com |
MPEG11-CH2CH2COONHS manufacturers
- 2,5-dioxopyrrolidin-1-yl 2,5,8,11,14,17,20,23,26,29,32,35,38-tridecaoxahentetracontan-41-oate
-
-
2026-07-24
- CAS:2207596-93-6
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- m-PEG12-NHS ester
-
-
2025-06-07
- CAS:2207596-93-6
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | MPEG11-CH2CH2COONHS Basic information |
| Product Name: | MPEG11-CH2CH2COONHS | | Synonyms: | MPEG11-CH2CH2COONHS;4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxaoctatriacontanoic acid, 2,5-dioxo-1-pyrrolidinyl ester;mPEG11-CH2CH2COONHS/4,7,10,13,16,19,22,25,28,31,34,37-Dodecaoxaoctatriacontanoic acid, 2,5-dioxo-1-pyrrolidinyl ester;2,5-dioxopyrrolidin-1-yl 2,5,8,11,14,17,20,23,26,29,32,35,38-tridecaoxahentetracontan-41-oate;2,5-Dioxopyrrolidin-1-yl 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaoctatriacontan-38-oate;mPEG11-C2-NHS | | CAS: | 2207596-93-6 | | MF: | C30H55NO16 | | MW: | 685.75 | | EINECS: | | | Product Categories: | | | Mol File: | 2207596-93-6.mol |  |
| | MPEG11-CH2CH2COONHS Chemical Properties |
| Boiling point | 684.3±65.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | -20°C, protect from light, stored under nitrogen | | form | Liquid | | color | Colorless to light yellow | | InChIKey | ZMXRHHJWXLKMTL-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC |
| | MPEG11-CH2CH2COONHS Usage And Synthesis |
| Uses | m-PEG12-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | Biological Activity | m-PEG12-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. | | IC 50 | PEGs; Alkyl/ether | | References | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
| | MPEG11-CH2CH2COONHS Preparation Products And Raw materials |
|