| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ac-His-OH H2O Basic information |
| | Ac-His-OH H2O Chemical Properties |
| Melting point | 163 °C | | alpha | [α]D20 +44~+47° (c=2, H2O) | | refractive index | 46.5 ° (C=1, H2O) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO (Slightly), Methanol (Sparingly, Heated), Water (Sparingly, Heated, Sonicat | | form | Powder | | color | White | | Water Solubility | Soluble in water. | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Cosmetics Ingredients Functions | HUMECTANT SKIN CONDITIONING SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1/C8H11N3O3.H2O/c1-5(12)11-7(8(13)14)2-6-3-9-4-10-6;/h3-4,7H,2H2,1H3,(H,9,10)(H,11,12)(H,13,14);1H2/t7-;/s3 | | InChIKey | PSWSDQRXCOJSFC-WMASNCOMNA-N | | SMILES | [C@H](C(=O)O)(NC(=O)C)CC1NC=NC=1.O |&1:0,r| | | LogP | -1.601 (est) | | CAS DataBase Reference | 39145-52-3 |
| Provider | Language |
|
ACROS
| English |
| | Ac-His-OH H2O Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | N-acetylhistidine, a novel osmolyte in the lens of Atlantic salmon. An ectotherm homologue of human predicted gene NAT16 encodes histidine N-acetyltransferase responsible for N±-acetylhistidine synthesis. | | Purification Methods | Crystallise it from water, then 4:1 acetone/water. [Marshall et al. J Am Chem Soc 78 4636 1956, Bergmann & Zervas Biochem Z 203 280 1928, Greenstein & Winitz The Chemistry of the Amino Acids J. Wiley, Vol 3 p 1990 1961, Beilstein 25 IV 4359.] |
| | Ac-His-OH H2O Preparation Products And Raw materials |
|