| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloro-3-nitrotoluene Basic information |
| | 2-Chloro-3-nitrotoluene Chemical Properties |
| Melting point | 21 °C (lit.) | | Boiling point | 147 °C/25 mmHg (lit.) | | density | 1.298 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.557(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Yellow | | InChI | InChI=1S/C7H6ClNO2/c1-5-3-2-4-6(7(5)8)9(10)11/h2-4H,1H3 | | InChIKey | XTSGZXRUCAWXKY-UHFFFAOYSA-N | | SMILES | C1(C)=CC=CC([N+]([O-])=O)=C1Cl | | CAS DataBase Reference | 3970-40-9(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 61 | | RIDADR | UN 2433 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
| | 2-Chloro-3-nitrotoluene Usage And Synthesis |
| Uses | 2-Chloro-3-nitrotoluene is an aryl halide that can be transformed into arenethiols by reacting with sodium sulphide, sodium hydrogen sulphide or disodium disulphide. |
| | 2-Chloro-3-nitrotoluene Preparation Products And Raw materials |
|