|
|
| | N-ACETYL-2-PHENYLETHYLAMINE Basic information |
| Product Name: | N-ACETYL-2-PHENYLETHYLAMINE | | Synonyms: | Glipizide Impurity 1;N-phenethylacetramide;Glipizide Impurity 15;(2-Phenethyl)acetamide;Acetamide, N-(2-phenylethyl)-;n-(2-phenylethyl)-acetamid;N-Acetylphenethylamine;n-beta-phenylethylacetamide | | CAS: | 877-95-2 | | MF: | C10H13NO | | MW: | 163.22 | | EINECS: | 212-897-8 | | Product Categories: | | | Mol File: | 877-95-2.mol |  |
| | N-ACETYL-2-PHENYLETHYLAMINE Chemical Properties |
| Melting point | 48-52 °C | | Boiling point | 154 °C / 2mmHg | | density | 1.012 | | refractive index | 1.5400 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 16.17±0.46(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C10H13NO/c1-9(12)11-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,11,12) | | InChIKey | MODKMHXGCGKTLE-UHFFFAOYSA-N | | SMILES | C(NCCC1=CC=CC=C1)(=O)C | | CAS DataBase Reference | 877-95-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | RTECS | AC7740000 | | HS Code | 29241900 |
| Provider | Language |
|
ACROS
| English |
| | N-ACETYL-2-PHENYLETHYLAMINE Usage And Synthesis |
| Chemical Properties | white to off-white low melting mass | | Uses | N-(2-Phenylethyl)acetamide can be used as an antimicrobial agent for aquaculture. | | Definition | ChEBI: N-acetylphenylethylamine is a N-acetyl-2-arylethylamine. | | Synthesis Reference(s) | Journal of the American Chemical Society, 105, p. 1054, 1983 DOI: 10.1021/ja00342a069 |
| | N-ACETYL-2-PHENYLETHYLAMINE Preparation Products And Raw materials |
|