| Company Name: |
Tetranov Biopharm
|
| Tel: |
13526569071 |
| Email: |
sales@leadmedpharm.com |
| Products Intro: |
Product Name:(4R,5S)-4-Methyl-5-phenyl-3-propionyloxazolidin-2-one CAS:77877-20-4 Purity:95% Package:1g;5g;25g;100g
|
| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Email: |
|
| Products Intro: |
Product Name:(4R,5S)-4-Methyl-5-phenyl-3-propionyl-2-oxazolidine CAS:77877-20-4 Purity:96%Min Package:10g 100g 500g
|
|
| | N-PROPIONYL-(4S,5R)-4-METHYL- 5-PHENYL-2-OXAZOLIDINONE Basic information |
| Product Name: | N-PROPIONYL-(4S,5R)-4-METHYL- 5-PHENYL-2-OXAZOLIDINONE | | Synonyms: | (4R,5S)-4-METHYL-5-PHENYL-3-PROPIONYL-2-OXAZOLIDINONE;N-PROPIONYL-(4R,5S)-4-METHYL- 5-PHENYL-2-OXAZOLIDINONE;N-PROPIONYL-(4S,5R)-4-METHYL- 5-PHENYL-2-OXAZOLIDINONE;(4R)-3-Propionyl-4α-methyl-5α-phenyloxazolidine-2-one;(4R,5S)-3-Propionyl-4-methyl-5-phenyloxazolidine-2-one;(4R,5S)-4-Methyl-3-propanoyl-5-phenyloxazolidine-2-one;3-Propanoyl-4α-methyl-5α-phenyloxazolidine-2-one;3-Propionyl-4α-methyl-5α-phenyloxazolidine-2-one | | CAS: | 77877-20-4 | | MF: | C13H15NO3 | | MW: | 233.26 | | EINECS: | | | Product Categories: | Peptide | | Mol File: | 77877-20-4.mol |  |
| | N-PROPIONYL-(4S,5R)-4-METHYL- 5-PHENYL-2-OXAZOLIDINONE Chemical Properties |
| Melting point | 96-97 °C | | Boiling point | 394.4±31.0 °C(Predicted) | | density | 1.161 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.530 | | Fp | 109℃ | | storage temp. | 2-8°C | | pka | -2.80±0.60(Predicted) | | Optical Rotation | [α]20/D +42±1°, c =2% in methylene chloride | | InChI | 1S/C13H15NO3/c1-3-11(15)14-9(2)12(17-13(14)16)10-7-5-4-6-8-10/h4-9,12H,3H2,1-2H3/t9-,12-/m1/s1 | | InChIKey | ZMRFZBKROHCLIL-BXKDBHETSA-N | | SMILES | CCC(=O)N1[C@H](C)[C@@H](OC1=O)c2ccccc2 |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 10 | | Storage Class | 10 - Combustible liquids |
| | N-PROPIONYL-(4S,5R)-4-METHYL- 5-PHENYL-2-OXAZOLIDINONE Usage And Synthesis |
| Uses | (4R,5S)-4-Methyl-5-phenyl-3-propionyl-2-oxazolidinone is used as a reactant in the synthesis of Lactimidomycin, a potent translation and cell migration inhibitor. |
| | N-PROPIONYL-(4S,5R)-4-METHYL- 5-PHENYL-2-OXAZOLIDINONE Preparation Products And Raw materials |
|