|
|
| | 1-Chloro-3-fluorobenzene Basic information |
| | 1-Chloro-3-fluorobenzene Chemical Properties |
| Melting point | <-78 °C | | Boiling point | 126-128 °C(lit.) | | density | 1.219 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.494(lit.) | | Fp | 68 °F | | storage temp. | Flammables area | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.219 | | Water Solubility | Not miscible in water. | | BRN | 2039303 | | Henry's Law Constant | 1.6×10-3 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | InChI | InChI=1S/C6H4ClF/c7-5-2-1-3-6(8)4-5/h1-4H | | InChIKey | VZHJIJZEOCBKRA-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(F)=C1 | | CAS DataBase Reference | 625-98-9(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1-chloro-3-fluoro-(625-98-9) | | EPA Substance Registry System | m-Chlorofluorobenzene (625-98-9) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-33-37/39 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Flammable/Irritant | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-Chloro-3-fluorobenzene Usage And Synthesis |
| Chemical Properties | Clear colourless to light yellow liquid | | Uses | 1-Chloro-3-fluorobenzene used as medicine and liquid crystal intermediates. | | General Description | Reaction of 1-chloro-3-fluorobenzene radical cation with NH3 has been investigated by FT-ICR spectrometry. It reacts with n-butyllithium to yield bicycloadducts via trapping of intermediate benzynes. |
| | 1-Chloro-3-fluorobenzene Preparation Products And Raw materials |
|